C16H18ClN5O2S2 — CID 9064567
(2S)-N-(2-chloro-3-pyridinyl)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 9064567) has the molecular formula C16H18ClN5O2S2 and a molecular weight of 411.94 g/mol. Its IUPAC name is (2S)-N-(2-chloro-3-pyridinyl)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(2-chloro-3-pyridinyl)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 9064567 |
| Molecular Formula | C16H18ClN5O2S2 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (2S)-N-(2-chloro-3-pyridinyl)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | CCC(=O)N(c1nnc(S[C@@H](C)C(=O)Nc2cccnc2Cl)s1)C1CC1 |
| InChI | InChI=1S/C16H18ClN5O2S2/c1-3-12(23)22(10-6-7-10)15-20-21-16(26-15)25-9(2)14(24)19-11-5-4-8-18-13(11)17/h4-5,8-10H,3,6-7H2,1-2H3,(H,19,24)/t9-/m0/s1 |
| InChIKey | UAUVQTBBYVGBHV-VIFPVBQESA-N |
| XLogP | 3.61 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|