C19H24N4O3S2 — CID 9064549
(2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-ethoxyphenyl)propanamide (PubChem CID 9064549) has the molecular formula C19H24N4O3S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is (2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-ethoxyphenyl)propanamide.
| Compound Name | (2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-ethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 9064549 |
| Molecular Formula | C19H24N4O3S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(4-ethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H](C)Sc2nnc(N(C(=O)CC)C3CC3)s2)cc1 |
| InChI | InChI=1S/C19H24N4O3S2/c1-4-16(24)23(14-8-9-14)18-21-22-19(28-18)27-12(3)17(25)20-13-6-10-15(11-7-13)26-5-2/h6-7,10-12,14H,4-5,8-9H2,1-3H3,(H,20,25)/t12-/m1/s1 |
| InChIKey | IOMDJGKAQJZZRJ-GFCCVEGCSA-N |
| XLogP | 3.96 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|