C19H23FN4O2S2 — CID 8783389
(2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(1R)-1-(4-fluorophenyl)ethyl]propanamide (PubChem CID 8783389) has the molecular formula C19H23FN4O2S2 and a molecular weight of 422.55 g/mol. Its IUPAC name is (2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(1R)-1-(4-fluorophenyl)ethyl]propanamide.
| Compound Name | (2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(1R)-1-(4-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 8783389 |
| Molecular Formula | C19H23FN4O2S2 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(1R)-1-(4-fluorophenyl)ethyl]propanamide |
| SMILES | CCC(=O)N(c1nnc(S[C@H](C)C(=O)N[C@H](C)c2ccc(F)cc2)s1)C1CC1 |
| InChI | InChI=1S/C19H23FN4O2S2/c1-4-16(25)24(15-9-10-15)18-22-23-19(28-18)27-12(3)17(26)21-11(2)13-5-7-14(20)8-6-13/h5-8,11-12,15H,4,9-10H2,1-3H3,(H,21,26)/t11-,12-/m1/s1 |
| InChIKey | DKNMQFKIAVKMRZ-VXGBXAGGSA-N |
| XLogP | 3.94 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|