C17H18FN3O2S2 — CID 8783396
N-cyclopropyl-N-[5-[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 8783396) has the molecular formula C17H18FN3O2S2 and a molecular weight of 379.48 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[5-[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 8783396 |
| Molecular Formula | C17H18FN3O2S2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-cyclopropyl-N-[5-[(2S)-1-(4-fluorophenyl)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nnc(S[C@@H](C)C(=O)c2ccc(F)cc2)s1)C1CC1 |
| InChI | InChI=1S/C17H18FN3O2S2/c1-3-14(22)21(13-8-9-13)16-19-20-17(25-16)24-10(2)15(23)11-4-6-12(18)7-5-11/h4-7,10,13H,3,8-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | FLTDROIXHNMYJW-JTQLQIEISA-N |
| XLogP | 3.95 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|