C18H20ClN3O3S2 — CID 166227466
N-[5-[1-(3-chloro-4-methoxyphenyl)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide (PubChem CID 166227466) has the molecular formula C18H20ClN3O3S2 and a molecular weight of 425.96 g/mol. Its IUPAC name is N-[5-[1-(3-chloro-4-methoxyphenyl)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide.
| Compound Name | N-[5-[1-(3-chloro-4-methoxyphenyl)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 166227466 |
| Molecular Formula | C18H20ClN3O3S2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-[5-[1-(3-chloro-4-methoxyphenyl)-1-oxopropan-2-yl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide |
| SMILES | CCC(=O)N(c1nnc(SC(C)C(=O)c2ccc(OC)c(Cl)c2)s1)C1CC1 |
| InChI | InChI=1S/C18H20ClN3O3S2/c1-4-15(23)22(12-6-7-12)17-20-21-18(27-17)26-10(2)16(24)11-5-8-14(25-3)13(19)9-11/h5,8-10,12H,4,6-7H2,1-3H3 |
| InChIKey | OVKJJEUFDUWFJO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|