C20H19F2N5O2S3 — CID 41190196
(2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 41190196) has the molecular formula C20H19F2N5O2S3 and a molecular weight of 495.60 g/mol. Its IUPAC name is (2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | (2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 41190196 |
| Molecular Formula | C20H19F2N5O2S3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | (2R)-2-[[5-[cyclopropyl(propanoyl)amino]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nnc(S[C@H](C)C(=O)Nc2nc(-c3ccc(F)c(F)c3)cs2)s1)C1CC1 |
| InChI | InChI=1S/C20H19F2N5O2S3/c1-3-16(28)27(12-5-6-12)19-25-26-20(32-19)31-10(2)17(29)24-18-23-15(9-30-18)11-4-7-13(21)14(22)8-11/h4,7-10,12H,3,5-6H2,1-2H3,(H,23,24,29)/t10-/m1/s1 |
| InChIKey | GXJXDJWJZXRBIM-SNVBAGLBSA-N |
| XLogP | 4.96 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|