C15H14F2N2O3S2 — CID 7737171
(2R)-2-(3,4-difluorophenyl)sulfanyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 7737171) has the molecular formula C15H14F2N2O3S2 and a molecular weight of 372.42 g/mol. Its IUPAC name is (2R)-2-(3,4-difluorophenyl)sulfanyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2R)-2-(3,4-difluorophenyl)sulfanyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 7737171 |
| Molecular Formula | C15H14F2N2O3S2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (2R)-2-(3,4-difluorophenyl)sulfanyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | C[C@@H](Sc1ccc(F)c(F)c1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H14F2N2O3S2/c1-9(23-11-4-7-13(16)14(17)8-11)15(20)19-10-2-5-12(6-3-10)24(18,21)22/h2-9H,1H3,(H,19,20)(H2,18,21,22)/t9-/m1/s1 |
| InChIKey | NBVSSOBNFOAKPC-SECBINFHSA-N |
| XLogP | 2.73 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |