C19H21N3O4S2 — CID 22777234
N-[4-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylphenyl]cyclopropanecarboxamide (PubChem CID 22777234) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 22777234 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-[4-[1-oxo-1-(4-sulfamoylanilino)propan-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
| SMILES | CC(Sc1ccc(NC(=O)C2CC2)cc1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H21N3O4S2/c1-12(18(23)21-15-6-10-17(11-7-15)28(20,25)26)27-16-8-4-14(5-9-16)22-19(24)13-2-3-13/h4-13H,2-3H2,1H3,(H,21,23)(H,22,24)(H2,20,25,26) |
| InChIKey | LPGHNWMCCLBYCP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |