C24H23N3O4S2 — CID 23098069
2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 23098069) has the molecular formula C24H23N3O4S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 23098069 |
| Molecular Formula | C24H23N3O4S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CC(Sc1ccc(NC(=O)/C=C/c2ccccc2)cc1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C24H23N3O4S2/c1-17(24(29)27-20-10-14-22(15-11-20)33(25,30)31)32-21-12-8-19(9-13-21)26-23(28)16-7-18-5-3-2-4-6-18/h2-17H,1H3,(H,26,28)(H,27,29)(H2,25,30,31)/b16-7+ |
| InChIKey | HCKLHFRNFLXBAD-FRKPEAEDSA-N |
| XLogP | 4.11 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|