C24H20Cl2N2O2S — CID 23096785
N-(3,4-dichlorophenyl)-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide (PubChem CID 23096785) has the molecular formula C24H20Cl2N2O2S and a molecular weight of 471.41 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 23096785 |
| Molecular Formula | C24H20Cl2N2O2S |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[4-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
| SMILES | CC(Sc1ccc(NC(=O)/C=C/c2ccccc2)cc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H20Cl2N2O2S/c1-16(24(30)28-19-10-13-21(25)22(26)15-19)31-20-11-8-18(9-12-20)27-23(29)14-7-17-5-3-2-4-6-17/h2-16H,1H3,(H,27,29)(H,28,30)/b14-7+ |
| InChIKey | OEKXSIAIVGKAIS-VGOFMYFVSA-N |
| XLogP | 6.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|