C26H26N2O2S — CID 18901816
N-(3,5-dimethylphenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide (PubChem CID 18901816) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 18901816 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[3-[[(E)-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(C)Sc2cccc(NC(=O)/C=C/c3ccccc3)c2)c1 |
| InChI | InChI=1S/C26H26N2O2S/c1-18-14-19(2)16-23(15-18)28-26(30)20(3)31-24-11-7-10-22(17-24)27-25(29)13-12-21-8-5-4-6-9-21/h4-17,20H,1-3H3,(H,27,29)(H,28,30)/b13-12+ |
| InChIKey | OKWGNOWDSFAMIY-OUKQBFOZSA-N |
| XLogP | 6.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|