C24H24N2O2S — CID 18905851
N-(3-methylphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanamide (PubChem CID 18905851) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanamide.
| Compound Name | N-(3-methylphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 18905851 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-(3-methylphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanamide |
| SMILES | Cc1cccc(NC(=O)C(C)Sc2cccc(NC(=O)Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H24N2O2S/c1-17-8-6-11-20(14-17)26-24(28)18(2)29-22-13-7-12-21(16-22)25-23(27)15-19-9-4-3-5-10-19/h3-14,16,18H,15H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | NOYQISHZLBNRMQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |