C24H24N2O3S — CID 18905866
N-(2-methoxyphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanamide (PubChem CID 18905866) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanamide.
| Compound Name | N-(2-methoxyphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 18905866 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanamide |
| SMILES | COc1ccccc1NC(=O)C(C)Sc1cccc(NC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N2O3S/c1-17(24(28)26-21-13-6-7-14-22(21)29-2)30-20-12-8-11-19(16-20)25-23(27)15-18-9-4-3-5-10-18/h3-14,16-17H,15H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | WKGUZCAZMNQIIE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |