C25H27N3O2S2 — CID 19316847
N-(2,5-dimethylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide (PubChem CID 19316847) has the molecular formula C25H27N3O2S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19316847 |
| Molecular Formula | C25H27N3O2S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SC(C)C(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C25H27N3O2S2/c1-16-12-13-17(2)22(14-16)27-24(29)18(3)32-20-9-7-8-19(15-20)26-25(31)28-21-10-5-6-11-23(21)30-4/h5-15,18H,1-4H3,(H,27,29)(H2,26,28,31) |
| InChIKey | INOPTLMMLUJHDA-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|