C25H24N4O2S3 — CID 19318143
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 19318143) has the molecular formula C25H24N4O2S3 and a molecular weight of 508.69 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 19318143 |
| Molecular Formula | C25H24N4O2S3 |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | COc1ccccc1NC(=S)Nc1cccc(SC(C)C(=O)Nc2nc3ccc(C)cc3s2)c1 |
| InChI | InChI=1S/C25H24N4O2S3/c1-15-11-12-20-22(13-15)34-25(28-20)29-23(30)16(2)33-18-8-6-7-17(14-18)26-24(32)27-19-9-4-5-10-21(19)31-3/h4-14,16H,1-3H3,(H2,26,27,32)(H,28,29,30) |
| InChIKey | KFWZKNZECPRTNZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|