C26H26N4OS3 — CID 19318107
N-(6-methyl-1,3-benzothiazol-2-yl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide (PubChem CID 19318107) has the molecular formula C26H26N4OS3 and a molecular weight of 506.72 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 19318107 |
| Molecular Formula | C26H26N4OS3 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccc(C)cc2)c1)C(=O)Nc1nc2ccc(C)cc2s1 |
| InChI | InChI=1S/C26H26N4OS3/c1-4-22(24(31)30-26-29-21-13-10-17(3)14-23(21)34-26)33-20-7-5-6-19(15-20)28-25(32)27-18-11-8-16(2)9-12-18/h5-15,22H,4H2,1-3H3,(H2,27,28,32)(H,29,30,31) |
| InChIKey | TZFADONQTWDUPU-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|