C27H24Cl2N4OS3 — CID 19316074
N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide (PubChem CID 19316074) has the molecular formula C27H24Cl2N4OS3 and a molecular weight of 587.62 g/mol. Its IUPAC name is N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide.
| Compound Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 19316074 |
| Molecular Formula | C27H24Cl2N4OS3 |
| Molecular Weight | 587.62 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccc(C)cc2)c1)C(=O)Nc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C27H24Cl2N4OS3/c1-3-24(25(34)33-27-32-23(15-36-27)21-12-9-17(28)13-22(21)29)37-20-6-4-5-19(14-20)31-26(35)30-18-10-7-16(2)8-11-18/h4-15,24H,3H2,1-2H3,(H2,30,31,35)(H,32,33,34) |
| InChIKey | WFHFTUABXOOWDX-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.62 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|