C29H30N4O3S3 — CID 19316076
N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide (PubChem CID 19316076) has the molecular formula C29H30N4O3S3 and a molecular weight of 578.79 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 19316076 |
| Molecular Formula | C29H30N4O3S3 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccc(C)cc2)c1)C(=O)Nc1nc(-c2ccc(OC)c(OC)c2)cs1 |
| InChI | InChI=1S/C29H30N4O3S3/c1-5-26(27(34)33-29-32-23(17-38-29)19-11-14-24(35-3)25(15-19)36-4)39-22-8-6-7-21(16-22)31-28(37)30-20-12-9-18(2)10-13-20/h6-17,26H,5H2,1-4H3,(H2,30,31,37)(H,32,33,34) |
| InChIKey | LOPWOQWPIZAPTD-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|