C26H29N3O3S2 — CID 19316719
N-(2,4-dimethoxyphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide (PubChem CID 19316719) has the molecular formula C26H29N3O3S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 19316719 |
| Molecular Formula | C26H29N3O3S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccc(C)cc2)c1)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C26H29N3O3S2/c1-5-24(25(30)29-22-14-13-20(31-3)16-23(22)32-4)34-21-8-6-7-19(15-21)28-26(33)27-18-11-9-17(2)10-12-18/h6-16,24H,5H2,1-4H3,(H,29,30)(H2,27,28,33) |
| InChIKey | HFXHCTINJAYVGV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|