C26H29N3O4S2 — CID 19317007
N-(2,4-dimethoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylbutanamide (PubChem CID 19317007) has the molecular formula C26H29N3O4S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylbutanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 19317007 |
| Molecular Formula | C26H29N3O4S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccccc2OC)c1)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C26H29N3O4S2/c1-5-24(25(30)28-21-14-13-18(31-2)16-23(21)33-4)35-19-10-8-9-17(15-19)27-26(34)29-20-11-6-7-12-22(20)32-3/h6-16,24H,5H2,1-4H3,(H,28,30)(H2,27,29,34) |
| InChIKey | CWPWNFVPMMSCSN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|