C21H22N4O2S3 — CID 19318173
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 19318173) has the molecular formula C21H22N4O2S3 and a molecular weight of 458.63 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 19318173 |
| Molecular Formula | C21H22N4O2S3 |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccccc2OC)c1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C21H22N4O2S3/c1-3-18(19(26)25-21-22-11-12-29-21)30-15-8-6-7-14(13-15)23-20(28)24-16-9-4-5-10-17(16)27-2/h4-13,18H,3H2,1-2H3,(H,22,25,26)(H2,23,24,28) |
| InChIKey | SMZLLGDSEHPLFQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|