C24H21F4N3O2S2 — CID 19317033
2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)butanamide (PubChem CID 19317033) has the molecular formula C24H21F4N3O2S2 and a molecular weight of 523.58 g/mol. Its IUPAC name is 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)butanamide.
| Compound Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)butanamide |
|---|---|
| PubChem CID | 19317033 |
| Molecular Formula | C24H21F4N3O2S2 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3,5,6-tetrafluorophenyl)butanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccccc2OC)c1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C24H21F4N3O2S2/c1-3-19(23(32)31-22-20(27)15(25)12-16(26)21(22)28)35-14-8-6-7-13(11-14)29-24(34)30-17-9-4-5-10-18(17)33-2/h4-12,19H,3H2,1-2H3,(H,31,32)(H2,29,30,34) |
| InChIKey | PHRAGIOOPUYPHC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|