C24H18F4N2O4S — CID 18895748
2-[[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895748) has the molecular formula C24H18F4N2O4S and a molecular weight of 506.48 g/mol. Its IUPAC name is 2-[[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895748 |
| Molecular Formula | C24H18F4N2O4S |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 2-[[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccccc2C(=O)O)c1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C24H18F4N2O4S/c1-2-18(23(32)30-21-19(27)16(25)11-17(26)20(21)28)35-13-7-5-6-12(10-13)29-22(31)14-8-3-4-9-15(14)24(33)34/h3-11,18H,2H2,1H3,(H,29,31)(H,30,32)(H,33,34) |
| InChIKey | AOMXBUZMBSNFQK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|