C24H21IN2O4S — CID 18895732
2-[[3-[1-(4-iodoanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895732) has the molecular formula C24H21IN2O4S and a molecular weight of 560.41 g/mol. Its IUPAC name is 2-[[3-[1-(4-iodoanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[1-(4-iodoanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895732 |
| Molecular Formula | C24H21IN2O4S |
| Molecular Weight | 560.41 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | 2-[[3-[1-(4-iodoanilino)-1-oxobutan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccccc2C(=O)O)c1)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C24H21IN2O4S/c1-2-21(23(29)26-16-12-10-15(25)11-13-16)32-18-7-5-6-17(14-18)27-22(28)19-8-3-4-9-20(19)24(30)31/h3-14,21H,2H2,1H3,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | QHDMQAJZBDTROA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.41 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|