C25H22N2O7S — CID 18895753
5-[2-[3-[(2-carboxybenzoyl)amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid (PubChem CID 18895753) has the molecular formula C25H22N2O7S and a molecular weight of 494.53 g/mol. Its IUPAC name is 5-[2-[3-[(2-carboxybenzoyl)amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[3-[(2-carboxybenzoyl)amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 18895753 |
| Molecular Formula | C25H22N2O7S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 5-[2-[3-[(2-carboxybenzoyl)amino]phenyl]sulfanylbutanoylamino]-2-hydroxybenzoic acid |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccccc2C(=O)O)c1)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C25H22N2O7S/c1-2-21(23(30)27-15-10-11-20(28)19(13-15)25(33)34)35-16-7-5-6-14(12-16)26-22(29)17-8-3-4-9-18(17)24(31)32/h3-13,21,28H,2H2,1H3,(H,26,29)(H,27,30)(H,31,32)(H,33,34) |
| InChIKey | OCQLZMYZPZPTQZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|