C24H20F4N2O2S — CID 18906896
3-methyl-N-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18906896) has the molecular formula C24H20F4N2O2S and a molecular weight of 476.50 g/mol. Its IUPAC name is 3-methyl-N-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 3-methyl-N-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18906896 |
| Molecular Formula | C24H20F4N2O2S |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 3-methyl-N-[3-[1-oxo-1-(2,3,5,6-tetrafluoroanilino)butan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2cccc(C)c2)c1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C24H20F4N2O2S/c1-3-19(24(32)30-22-20(27)17(25)12-18(26)21(22)28)33-16-9-5-8-15(11-16)29-23(31)14-7-4-6-13(2)10-14/h4-12,19H,3H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | GJSPSMXMKPAGIP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|