C24H16F8N2O2S — CID 18904017
2-fluoro-N-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylphenyl]benzamide (PubChem CID 18904017) has the molecular formula C24H16F8N2O2S and a molecular weight of 548.46 g/mol. Its IUPAC name is 2-fluoro-N-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18904017 |
| Molecular Formula | C24H16F8N2O2S |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | 2-fluoro-N-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylphenyl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)c2ccccc2F)c1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C24H16F8N2O2S/c1-2-15(23(36)34-21-19(28)17(26)16(24(30,31)32)18(27)20(21)29)37-12-7-5-6-11(10-12)33-22(35)13-8-3-4-9-14(13)25/h3-10,15H,2H2,1H3,(H,33,35)(H,34,36) |
| InChIKey | ZEPDPFZYYUDMDP-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|