C31H22F7N3O3S2 — CID 19313002
N-[(Z)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 19313002) has the molecular formula C31H22F7N3O3S2 and a molecular weight of 681.66 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19313002 |
| Molecular Formula | C31H22F7N3O3S2 |
| Molecular Weight | 681.66 g/mol |
| Exact Mass | 681.10 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)c1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C31H22F7N3O3S2/c1-2-21(30(44)41-27-25(34)23(32)22(31(36,37)38)24(33)26(27)35)46-19-11-6-10-17(14-19)39-29(43)20(15-18-12-7-13-45-18)40-28(42)16-8-4-3-5-9-16/h3-15,21H,2H2,1H3,(H,39,43)(H,40,42)(H,41,44)/b20-15- |
| InChIKey | WHNUNACPZHUNAK-HKWRFOASSA-N |
| XLogP | 8.24 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.66 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|