C31H29N3O3S2 — CID 19312965
N-[(Z)-3-[3-[1-(4-methylanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 19312965) has the molecular formula C31H29N3O3S2 and a molecular weight of 555.73 g/mol. Its IUPAC name is N-[(Z)-3-[3-[1-(4-methylanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[1-(4-methylanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312965 |
| Molecular Formula | C31H29N3O3S2 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | N-[(Z)-3-[3-[1-(4-methylanilino)-1-oxobutan-2-yl]sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)c1)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C31H29N3O3S2/c1-3-28(31(37)32-23-16-14-21(2)15-17-23)39-26-12-7-11-24(19-26)33-30(36)27(20-25-13-8-18-38-25)34-29(35)22-9-5-4-6-10-22/h4-20,28H,3H2,1-2H3,(H,32,37)(H,33,36)(H,34,35)/b27-20- |
| InChIKey | JFGAJYMWHOUNBI-OOAXWGSJSA-N |
| XLogP | 6.98 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|