C35H35N3O3S — CID 19313537
N-[(E)-3-[3-[1-(3,5-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19313537) has the molecular formula C35H35N3O3S and a molecular weight of 577.75 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-(3,5-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-(3,5-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19313537 |
| Molecular Formula | C35H35N3O3S |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | N-[(E)-3-[3-[1-(3,5-dimethylanilino)-1-oxobutan-2-yl]sulfanylanilino]-1-(3-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cccc(C)c2)NC(=O)c2ccccc2)c1)C(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C35H35N3O3S/c1-5-32(35(41)37-29-19-24(3)17-25(4)20-29)42-30-16-10-15-28(22-30)36-34(40)31(21-26-12-9-11-23(2)18-26)38-33(39)27-13-7-6-8-14-27/h6-22,32H,5H2,1-4H3,(H,36,40)(H,37,41)(H,38,39)/b31-21+ |
| InChIKey | ULRWDPGQVALVBL-NJZRLIGZSA-N |
| XLogP | 7.53 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|