C36H29N3O3S2 — CID 19300829
N-[(E)-3-[3-(1-carbazol-9-yl-1-oxobutan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 19300829) has the molecular formula C36H29N3O3S2 and a molecular weight of 615.78 g/mol. Its IUPAC name is N-[(E)-3-[3-(1-carbazol-9-yl-1-oxobutan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-(1-carbazol-9-yl-1-oxobutan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300829 |
| Molecular Formula | C36H29N3O3S2 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | N-[(E)-3-[3-(1-carbazol-9-yl-1-oxobutan-2-yl)sulfanylanilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cccs2)NC(=O)c2ccccc2)c1)C(=O)n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C36H29N3O3S2/c1-2-33(36(42)39-31-19-8-6-17-28(31)29-18-7-9-20-32(29)39)44-27-15-10-14-25(22-27)37-35(41)30(23-26-16-11-21-43-26)38-34(40)24-12-4-3-5-13-24/h3-23,33H,2H2,1H3,(H,37,41)(H,38,40)/b30-23+ |
| InChIKey | BPELXGSHIGWUHP-JJKYIXSRSA-N |
| XLogP | 8.48 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|