C29H18F7N3O3S2 — CID 19312930
N-[(Z)-3-oxo-3-[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 19312930) has the molecular formula C29H18F7N3O3S2 and a molecular weight of 653.60 g/mol. Its IUPAC name is N-[(Z)-3-oxo-3-[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-oxo-3-[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312930 |
| Molecular Formula | C29H18F7N3O3S2 |
| Molecular Weight | 653.60 g/mol |
| Exact Mass | 653.07 |
| IUPAC Name | N-[(Z)-3-oxo-3-[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)c1)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C29H18F7N3O3S2/c30-22-21(29(34,35)36)23(31)25(33)26(24(22)32)39-20(40)14-44-17-9-4-8-16(12-17)37-28(42)19(13-18-10-5-11-43-18)38-27(41)15-6-2-1-3-7-15/h1-13H,14H2,(H,37,42)(H,38,41)(H,39,40)/b19-13- |
| InChIKey | NUQSYJJIVRKMEA-UYRXBGFRSA-N |
| XLogP | 7.46 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.60 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|