C31H19BrF7N3O3S — CID 19315234
N-[(E)-1-(4-bromophenyl)-3-oxo-3-[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19315234) has the molecular formula C31H19BrF7N3O3S and a molecular weight of 726.47 g/mol. Its IUPAC name is N-[(E)-1-(4-bromophenyl)-3-oxo-3-[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(4-bromophenyl)-3-oxo-3-[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19315234 |
| Molecular Formula | C31H19BrF7N3O3S |
| Molecular Weight | 726.47 g/mol |
| Exact Mass | 725.02 |
| IUPAC Name | N-[(E)-1-(4-bromophenyl)-3-oxo-3-[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2ccc(Br)cc2)NC(=O)c2ccccc2)c1)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C31H19BrF7N3O3S/c32-18-11-9-16(10-12-18)13-21(41-29(44)17-5-2-1-3-6-17)30(45)40-19-7-4-8-20(14-19)46-15-22(43)42-28-26(35)24(33)23(31(37,38)39)25(34)27(28)36/h1-14H,15H2,(H,40,45)(H,41,44)(H,42,43)/b21-13+ |
| InChIKey | SSELBXKHSFVADA-FYJGNVAPSA-N |
| XLogP | 8.16 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.47 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|