C33H25F7N4O3S — CID 21386359
N-[(Z)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 21386359) has the molecular formula C33H25F7N4O3S and a molecular weight of 690.64 g/mol. Its IUPAC name is N-[(Z)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386359 |
| Molecular Formula | C33H25F7N4O3S |
| Molecular Weight | 690.64 g/mol |
| Exact Mass | 690.15 |
| IUPAC Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-oxo-3-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3c(F)c(F)c(C(F)(F)F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C33H25F7N4O3S/c1-44(2)21-12-8-18(9-13-21)16-23(42-31(46)19-6-4-3-5-7-19)32(47)41-20-10-14-22(15-11-20)48-17-24(45)43-30-28(36)26(34)25(33(38,39)40)27(35)29(30)37/h3-16H,17H2,1-2H3,(H,41,47)(H,42,46)(H,43,45)/b23-16- |
| InChIKey | OAPUPRMTBGUYIX-KQWNVCNZSA-N |
| XLogP | 7.47 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.64 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|