C35H22F7N3O3S — CID 22188427
N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 22188427) has the molecular formula C35H22F7N3O3S and a molecular weight of 697.63 g/mol. Its IUPAC name is N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188427 |
| Molecular Formula | C35H22F7N3O3S |
| Molecular Weight | 697.63 g/mol |
| Exact Mass | 697.13 |
| IUPAC Name | N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[4-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2cccc3ccccc23)NC(=O)c2ccccc2)cc1)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C35H22F7N3O3S/c36-28-27(35(40,41)42)29(37)31(39)32(30(28)38)45-26(46)18-49-23-15-13-22(14-16-23)43-34(48)25(44-33(47)20-8-2-1-3-9-20)17-21-11-6-10-19-7-4-5-12-24(19)21/h1-17H,18H2,(H,43,48)(H,44,47)(H,45,46)/b25-17- |
| InChIKey | QSOLCQCGSCTRQO-UQQQWYQISA-N |
| XLogP | 8.56 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.63 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|