C34H25BrFN3O3S — CID 22188369
N-[(Z)-3-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22188369) has the molecular formula C34H25BrFN3O3S and a molecular weight of 654.56 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22188369 |
| Molecular Formula | C34H25BrFN3O3S |
| Molecular Weight | 654.56 g/mol |
| Exact Mass | 653.08 |
| IUPAC Name | N-[(Z)-3-[4-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]sulfanylanilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2cccc3ccccc23)NC(=O)c2ccccc2)cc1)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C34H25BrFN3O3S/c35-25-13-18-30(29(36)20-25)38-32(40)21-43-27-16-14-26(15-17-27)37-34(42)31(39-33(41)23-8-2-1-3-9-23)19-24-11-6-10-22-7-4-5-12-28(22)24/h1-20H,21H2,(H,37,42)(H,38,40)(H,39,41)/b31-19- |
| InChIKey | WXPLCSCLZQKAOB-DXJNIWACSA-N |
| XLogP | 7.88 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.56 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|