C32H25F4N3O5S — CID 21385518
N-[(Z)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 21385518) has the molecular formula C32H25F4N3O5S and a molecular weight of 639.63 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385518 |
| Molecular Formula | C32H25F4N3O5S |
| Molecular Weight | 639.63 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | N-[(Z)-1-(2,3-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)Nc3c(F)c(F)cc(F)c3F)cc2)c1OC |
| InChI | InChI=1S/C32H25F4N3O5S/c1-43-25-10-6-9-19(30(25)44-2)15-24(38-31(41)18-7-4-3-5-8-18)32(42)37-20-11-13-21(14-12-20)45-17-26(40)39-29-27(35)22(33)16-23(34)28(29)36/h3-16H,17H2,1-2H3,(H,37,42)(H,38,41)(H,39,40)/b24-15- |
| InChIKey | DPJJGHAPIZVGED-IWIPYMOSSA-N |
| XLogP | 6.40 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|