C30H20ClF4N3O3S — CID 21384258
N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 21384258) has the molecular formula C30H20ClF4N3O3S and a molecular weight of 614.02 g/mol. Its IUPAC name is N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21384258 |
| Molecular Formula | C30H20ClF4N3O3S |
| Molecular Weight | 614.02 g/mol |
| Exact Mass | 613.09 |
| IUPAC Name | N-[(Z)-1-(3-chlorophenyl)-3-oxo-3-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2cccc(Cl)c2)NC(=O)c2ccccc2)cc1)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C30H20ClF4N3O3S/c31-19-8-4-5-17(13-19)14-24(37-29(40)18-6-2-1-3-7-18)30(41)36-20-9-11-21(12-10-20)42-16-25(39)38-28-26(34)22(32)15-23(33)27(28)35/h1-15H,16H2,(H,36,41)(H,37,40)(H,38,39)/b24-14- |
| InChIKey | RBTTVEVRKKQXIG-OYKKKHCWSA-N |
| XLogP | 7.04 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.02 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|