C32H24ClN3O4S — CID 22783815
N-[(Z)-1-(3-chlorophenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22783815) has the molecular formula C32H24ClN3O4S and a molecular weight of 582.08 g/mol. Its IUPAC name is N-[(Z)-1-(3-chlorophenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3-chlorophenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783815 |
| Molecular Formula | C32H24ClN3O4S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.12 |
| IUPAC Name | N-[(Z)-1-(3-chlorophenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCCN2C(=O)c3ccccc3C2=O)cc1)/C(=C/c1cccc(Cl)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H24ClN3O4S/c33-23-10-6-7-21(19-23)20-28(35-29(37)22-8-2-1-3-9-22)30(38)34-24-13-15-25(16-14-24)41-18-17-36-31(39)26-11-4-5-12-27(26)32(36)40/h1-16,19-20H,17-18H2,(H,34,38)(H,35,37)/b28-20- |
| InChIKey | XOAJUYWGHXURGU-RRAHZORUSA-N |
| XLogP | 6.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|