C32H23BrFN3O4S — CID 23101884
N-[(E)-1-(4-bromophenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide (PubChem CID 23101884) has the molecular formula C32H23BrFN3O4S and a molecular weight of 644.52 g/mol. Its IUPAC name is N-[(E)-1-(4-bromophenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(E)-1-(4-bromophenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 23101884 |
| Molecular Formula | C32H23BrFN3O4S |
| Molecular Weight | 644.52 g/mol |
| Exact Mass | 643.06 |
| IUPAC Name | N-[(E)-1-(4-bromophenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(SCCN2C(=O)c3ccccc3C2=O)cc1)/C(=C\c1ccc(Br)cc1)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C32H23BrFN3O4S/c33-21-11-9-20(10-12-21)19-28(36-29(38)26-7-3-4-8-27(26)34)30(39)35-22-13-15-23(16-14-22)42-18-17-37-31(40)24-5-1-2-6-25(24)32(37)41/h1-16,19H,17-18H2,(H,35,39)(H,36,38)/b28-19+ |
| InChIKey | YRDPNQAWBXXGCY-TURZUDJPSA-N |
| XLogP | 6.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|