C36H27BrFN3O4S — CID 23102060
N-[(E)-1-(4-bromophenyl)-3-oxo-3-[4-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]-2-fluorobenzamide (PubChem CID 23102060) has the molecular formula C36H27BrFN3O4S and a molecular weight of 696.60 g/mol. Its IUPAC name is N-[(E)-1-(4-bromophenyl)-3-oxo-3-[4-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(E)-1-(4-bromophenyl)-3-oxo-3-[4-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 23102060 |
| Molecular Formula | C36H27BrFN3O4S |
| Molecular Weight | 696.60 g/mol |
| Exact Mass | 695.09 |
| IUPAC Name | N-[(E)-1-(4-bromophenyl)-3-oxo-3-[4-[2-oxo-2-(4-phenoxyanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]-2-fluorobenzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C\c2ccc(Br)cc2)NC(=O)c2ccccc2F)cc1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C36H27BrFN3O4S/c37-25-12-10-24(11-13-25)22-33(41-35(43)31-8-4-5-9-32(31)38)36(44)40-27-16-20-30(21-17-27)46-23-34(42)39-26-14-18-29(19-15-26)45-28-6-2-1-3-7-28/h1-22H,23H2,(H,39,42)(H,40,44)(H,41,43)/b33-22+ |
| InChIKey | COIXWIBIKYFRIQ-STKMKYKTSA-N |
| XLogP | 8.52 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.60 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|