C40H35BrFN3O4S — CID 99665543
N-[(E)-1-(4-bromophenyl)-3-[4-[(1R)-2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide (PubChem CID 99665543) has the molecular formula C40H35BrFN3O4S and a molecular weight of 752.71 g/mol. Its IUPAC name is N-[(E)-1-(4-bromophenyl)-3-[4-[(1R)-2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide.
| Compound Name | N-[(E)-1-(4-bromophenyl)-3-[4-[(1R)-2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 99665543 |
| Molecular Formula | C40H35BrFN3O4S |
| Molecular Weight | 752.71 g/mol |
| Exact Mass | 751.15 |
| IUPAC Name | N-[(E)-1-(4-bromophenyl)-3-[4-[(1R)-2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]-2-fluorobenzamide |
| SMILES | CCCCOc1ccc(NC(=O)[C@H](Sc2ccc(NC(=O)/C(=C\c3ccc(Br)cc3)NC(=O)c3ccccc3F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H35BrFN3O4S/c1-2-3-25-49-32-21-17-30(18-22-32)44-40(48)37(28-9-5-4-6-10-28)50-33-23-19-31(20-24-33)43-39(47)36(26-27-13-15-29(41)16-14-27)45-38(46)34-11-7-8-12-35(34)42/h4-24,26,37H,2-3,25H2,1H3,(H,43,47)(H,44,48)(H,45,46)/b36-26+/t37-/m1/s1 |
| InChIKey | ZCIULIKWUWBBJO-WYGFWKCJSA-N |
| XLogP | 9.65 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.71 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|