C39H31N3O4S — CID 22784296
N-[(Z)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]anilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22784296) has the molecular formula C39H31N3O4S and a molecular weight of 637.76 g/mol. Its IUPAC name is N-[(Z)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]anilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]anilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784296 |
| Molecular Formula | C39H31N3O4S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | N-[(Z)-3-[4-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]anilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(SCCCN2C(=O)c3ccccc3C2=O)cc1)/C(=C/c1ccc(-c2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C39H31N3O4S/c43-36(30-12-5-2-6-13-30)41-35(26-27-16-18-29(19-17-27)28-10-3-1-4-11-28)37(44)40-31-20-22-32(23-21-31)47-25-9-24-42-38(45)33-14-7-8-15-34(33)39(42)46/h1-8,10-23,26H,9,24-25H2,(H,40,44)(H,41,43)/b35-26- |
| InChIKey | ODANDCSAMRVQDF-JYUHDHNASA-N |
| XLogP | 7.54 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|