C34H30N2O5S — CID 22784283
ethyl 4-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-3-oxobutanoate (PubChem CID 22784283) has the molecular formula C34H30N2O5S and a molecular weight of 578.69 g/mol. Its IUPAC name is ethyl 4-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-3-oxobutanoate.
| Compound Name | ethyl 4-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 22784283 |
| Molecular Formula | C34H30N2O5S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | ethyl 4-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1ccc(NC(=O)/C(=C/c2ccc(-c3ccccc3)cc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H30N2O5S/c1-2-41-32(38)22-29(37)23-42-30-19-17-28(18-20-30)35-34(40)31(36-33(39)27-11-7-4-8-12-27)21-24-13-15-26(16-14-24)25-9-5-3-6-10-25/h3-21H,2,22-23H2,1H3,(H,35,40)(H,36,39)/b31-21- |
| InChIKey | MOJVPLUJOSYJJM-YQYKVWLJSA-N |
| XLogP | 6.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|