C28H25N3O7S — CID 22783843
ethyl 4-[4-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-3-oxobutanoate (PubChem CID 22783843) has the molecular formula C28H25N3O7S and a molecular weight of 547.59 g/mol. Its IUPAC name is ethyl 4-[4-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-3-oxobutanoate.
| Compound Name | ethyl 4-[4-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 22783843 |
| Molecular Formula | C28H25N3O7S |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | ethyl 4-[4-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1ccc(NC(=O)/C(=C\c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25N3O7S/c1-2-38-26(33)17-22(32)18-39-23-14-12-21(13-15-23)29-28(35)24(30-27(34)19-8-4-3-5-9-19)16-20-10-6-7-11-25(20)31(36)37/h3-16H,2,17-18H2,1H3,(H,29,35)(H,30,34)/b24-16+ |
| InChIKey | BDURIKVQRZWJOO-LFVJCYFKSA-N |
| XLogP | 4.62 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|