C26H22Cl2N2O4S — CID 22783882
ethyl 2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate (PubChem CID 22783882) has the molecular formula C26H22Cl2N2O4S and a molecular weight of 529.45 g/mol. Its IUPAC name is ethyl 2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate.
| Compound Name | ethyl 2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 22783882 |
| Molecular Formula | C26H22Cl2N2O4S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | ethyl 2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1ccc(NC(=O)/C(=C/c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22Cl2N2O4S/c1-2-34-24(31)16-35-21-12-10-20(11-13-21)29-26(33)23(14-18-8-9-19(27)15-22(18)28)30-25(32)17-6-4-3-5-7-17/h3-15H,2,16H2,1H3,(H,29,33)(H,30,32)/b23-14- |
| InChIKey | PZPKZWYSZYPLPF-UCQKPKSFSA-N |
| XLogP | 6.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|