C31H22Cl3N3O5S — CID 21385090
5-[[2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-chlorobenzoic acid (PubChem CID 21385090) has the molecular formula C31H22Cl3N3O5S and a molecular weight of 654.96 g/mol. Its IUPAC name is 5-[[2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-chlorobenzoic acid.
| Compound Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 21385090 |
| Molecular Formula | C31H22Cl3N3O5S |
| Molecular Weight | 654.96 g/mol |
| Exact Mass | 653.03 |
| IUPAC Name | 5-[[2-[4-[[(Z)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-2-chlorobenzoic acid |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)cc1)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C31H22Cl3N3O5S/c32-20-7-6-19(26(34)15-20)14-27(37-29(39)18-4-2-1-3-5-18)30(40)36-21-8-11-23(12-9-21)43-17-28(38)35-22-10-13-25(33)24(16-22)31(41)42/h1-16H,17H2,(H,35,38)(H,36,40)(H,37,39)(H,41,42)/b27-14- |
| InChIKey | BSWSBXWINVPOSM-VYYCAZPPSA-N |
| XLogP | 7.49 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.96 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|