C29H22Cl2N4O3S — CID 19713809
N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[2-oxo-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19713809) has the molecular formula C29H22Cl2N4O3S and a molecular weight of 577.49 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[2-oxo-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[2-oxo-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19713809 |
| Molecular Formula | C29H22Cl2N4O3S |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 576.08 |
| IUPAC Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[2-oxo-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)cc1)Nc1ccccn1 |
| InChI | InChI=1S/C29H22Cl2N4O3S/c30-21-10-9-20(24(31)17-21)16-25(34-28(37)19-6-2-1-3-7-19)29(38)33-22-11-13-23(14-12-22)39-18-27(36)35-26-8-4-5-15-32-26/h1-17H,18H2,(H,33,38)(H,34,37)(H,32,35,36)/b25-16- |
| InChIKey | UBVOEHWNRSTOHR-XYGWBWBKSA-N |
| XLogP | 6.53 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|