C27H22N4O4S — CID 19714607
N-[(Z)-1-(furan-2-yl)-3-oxo-3-[4-[2-oxo-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19714607) has the molecular formula C27H22N4O4S and a molecular weight of 498.56 g/mol. Its IUPAC name is N-[(Z)-1-(furan-2-yl)-3-oxo-3-[4-[2-oxo-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[4-[2-oxo-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19714607 |
| Molecular Formula | C27H22N4O4S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | N-[(Z)-1-(furan-2-yl)-3-oxo-3-[4-[2-oxo-2-(pyridin-2-ylamino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)cc1)Nc1ccccn1 |
| InChI | InChI=1S/C27H22N4O4S/c32-25(31-24-10-4-5-15-28-24)18-36-22-13-11-20(12-14-22)29-27(34)23(17-21-9-6-16-35-21)30-26(33)19-7-2-1-3-8-19/h1-17H,18H2,(H,29,34)(H,30,33)(H,28,31,32)/b23-17- |
| InChIKey | QAJTXPHVULWWTO-QJOMJCCJSA-N |
| XLogP | 4.82 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|