C29H23N3O6S — CID 19310907
4-[[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 19310907) has the molecular formula C29H23N3O6S and a molecular weight of 541.59 g/mol. Its IUPAC name is 4-[[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 19310907 |
| Molecular Formula | C29H23N3O6S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | 4-[[2-[3-[[(Z)-2-benzamido-3-(furan-2-yl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2ccco2)NC(=O)c2ccccc2)c1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C29H23N3O6S/c33-26(30-21-13-11-20(12-14-21)29(36)37)18-39-24-10-4-8-22(16-24)31-28(35)25(17-23-9-5-15-38-23)32-27(34)19-6-2-1-3-7-19/h1-17H,18H2,(H,30,33)(H,31,35)(H,32,34)(H,36,37)/b25-17- |
| InChIKey | NZXVCXOMQNUFGH-UQQQWYQISA-N |
| XLogP | 5.12 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|